My experiment with the cold and warm water changed my thinking about the Investigation Question because it showed me that the temperature of something can have a major impact on its properties.
Experiment with cold and warm waterFor example, warm water was more buoyant than cold water, which meant that the warmer water was able to float objects that the colder water could not. This showed me that temperature can play a role in the physical properties of an object, making it either lighter or heavier, depending on the temperature.
My experiment with cold and warm water showed me that temperature can have a major effect on physical properties. When comparing cold and warm water, I found that the warmer water was more buoyant and was able to float objects that the colder water could not.
This demonstrated to me how temperature can impact the weight and buoyancy of an object, making it either lighter or heavier depending on the temperature.
Learn more Experiment here:
https://brainly.com/question/17274244
#SPJ1
CAN SOMEONE HELP WITH THIS QUESTION?✨
Fe²⁺ is the reducing agent in this reaction.
In the given chemical reaction:
[tex]Cr_2O_7^{2-} + 6Fe_2+ + 14H^+ -- > 2Cr_3+ + 6Fe_3+ + 7H_2O[/tex]
We can see that Fe²⁺ is being oxidized to Fe³⁺ as it loses one electron and its oxidation state increases from +2 to +3. This means that Fe²⁺ is giving away electrons, which makes it the species that is being oxidized or the reducing agent.
Therefore, Fe²⁺ is the reducing agent in this reaction.
There are species in a chemical reaction that experience changes in their oxidation states, meaning they either acquire or lose electrons. Because it reduces another species by transferring electrons to it, the species that sheds electrons is known as the reducing agent.
The species that acquires electrons is known as the oxidizing agent because, by taking electrons from another species, it oxidizes that species.
learn more about reducing agent here
https://brainly.com/question/12549467
#SPJ1
How many grams of hydrogen chloride can be produced from 0.490 g of hydrogen and 50.0 g chlorine? The balanced equation is:
H₂(g) + Cl₂(g) → 2 HCI(g)
Hydrogen is the limiting reactant and chlorine is in excess since there is less hydrogen chloride that can be made from it (4.56 g) than there is chlorine (51.7 g) that can. As a result, 4.56 g of hydrogen chloride can be generated.
From 0.490 g of hydrogen and 50.0 g of chlorine, how many grams of hydrogen chloride may be produced?Let's first determine how much hydrogen chloride can be made from 0.490 g of hydrogen. We'll convert from moles of hydrogen to moles of hydrogen chloride using the balanced chemical equation:
1 mole of H2 yields 2 moles of HCl.
4.56 g HCl is equal to 0.490 g H2 times (1 mole H2 / 2.016 g H2), 2 moles HCl to 1 mole H2, and 36.46 g HCl to 1 mole H2.
The result is that 4.56 g of hydrogen chloride may be made from 0.490 g of hydrogen.
Let's now determine how much hydrogen chloride 50 g of chlorine can yield:
Cl2 creates 2 moles of HCl from 1 mole.
50.0 g Cl2 multiplied by (1 mole Cl2/70.90 g Cl2), (2 moles HCl/Mole Cl2), and (36.46 g/Mole Cl2) results in 51.7 g HCl.
The result is that 50.0 g of chlorine can make 51.7 g of hydrogen chloride.
To know more about chlorine gas visit:
https://brainly.com/question/29577369
#SPJ1
It took 4.5 minutes for 1.0 L helium to effuse through a porous
barrier. How long will it take for 1.0 L Cl 2 gas to effuse under
identical conditions?
It took 19 minutes for 1.0L Cl₂ gas to effuse under identical conditions.
How to calculate the time required to effuse a gas under identical conditions?1.0 L He = 4.5 min
1.0 L Cl₂ = x min
1.0 L He = 4.5 min = 0.22[tex]\frac{L}{min}[/tex]
Now, find the rate of Cl₂ using the molar mass of Cl₂ divided by the molar mass of He: [tex]\frac{0.22}{xCl2}[/tex] = 0.52 [tex]\frac{L}{min}[/tex]
Now, we need to solve for the time Cl₂ to effuse through a porous barrier, by setting it up as a proportion;
[tex]\frac{0.52L}{1 min}[/tex] = [tex]\frac{1.0L}{x min}[/tex]
= 19 minutes.
Hence, It tooks 19 minutes for 1.0L Cl₂ gas to effuse under identical conditions.
Learn more about gas here:
https://brainly.com/question/3637358
#SPJ1
What is the pH of solution containing 2.3x10^-² mol/l of H* ions?
Answer:
4.25^²
Explanation:
pH H*is the same as 4.25^²
Q. The order of acidic strength of hydrogen halides is: acid HF < HCl CH-1 > Br¹>1-1 (b) F-1 < CH-1 < Br¹ Br¹> -1 (d) F-1> CI-1 < Br¹> -1. Hint: A strong acid has a weak conjugate base and vice versa.
Answer:
im just here grabbing points dont take me as rude or anything
Explanation:
yours appreciatively bye
What are the carbohydrates’ that give positive result with Seliwanoff ? why?
Answer:
Fructose and sucrose
Explanation:
Sucrose gives a positive test as it is a disaccharide consorting of fructose and glucose
Explain which direction the molecules will move during diffusion.
Answer: During diffusion, molecules flow down their concentration gradient.
Explanation:
They're flowing from an area of high concentration to an area of low concentration. Molecules flowing down a concentration gradient is a natural process and does not require energy.
Gallium is a solid metal at room temperature but melts at 29.9 °C. If you hold gallium in your hand, it melts from body heat. How much heat must 2.5 g of gallium absorb from your hand to raise its temperature from 25.0 °C to 29.9 °C? The specific heat capacity of gallium is 0.372 J/g
In order for 2.5 g of gallium to transform from a solid state at 25.0 °C to a liquid state at 29.9 °C, it would require absorbing 19.56 J of heat from your hand.
Why is gallium utilised in high temperature applications?Only gallium has a low melting point of 29.7°C and a high boiling point of 1500–2000°C. Together with these peculiar characteristics, it also exhibits undercooling (20 °C or below), which would make it a perfect thermometric liquid if not for its propensity to wet quartz and glass surfaces.
Q1 = m × c × ΔT
Q1 = 2.5 g × 0.372 J/g·°C × (29.9 °C - 25.0 °C)
Q1 = 5.58 J
Q2 = m × ΔH_fusion
Q2 = 2.5 g × 5.59 J/g
Q2 = 13.98 J
Q_total = Q1 + Q2
Q_total = 5.58 J + 13.98 J
Q_total = 19.56 J
To know more about solid state visit:-
https://brainly.com/question/29488795
#SPJ1
Given the thermochemical equations
X2+3Y2⟶2XY3Δ1=−370 kJ
X2+2Z2⟶2XZ2Δ2=−130 kJ
2Y2+Z2⟶2Y2ZΔ3=−220 kJ
Calculate the change in enthalpy for the reaction.
4XY3+7Z2⟶6Y2Z+4XZ2
The change in enthalpy for the given reaction is +330 kJ.
To calculate the change in enthalpy for the reaction:
4XY3 + 7Z2 ⟶ 6Y2Z + 4XZ2
we need to use the Hess's Law, which states that if a chemical reaction can be expressed as the sum of several stepwise reactions, the enthalpy change of the overall reaction is equal to the sum of the enthalpy changes of the individual reactions.
We can write the reaction in terms of the given thermochemical equations as follows:
4XY3 ⟶ 2X2 + 6Y2 (reverse of equation 1, with ΔH = +370 kJ)
2X2 + 4XZ2 ⟶ 8XY3 (multiply equation 2 by 2, with ΔH = -2×130 kJ = -260 kJ)
2Y2 + Z2 ⟶ 2Y2Z (reverse of equation 3, with ΔH = +220 kJ)
Adding these three equations gives:
4XY3 + 7Z2 ⟶ 6Y2Z + 4XZ2 (with ΔH = 370 kJ - 260 kJ + 220 kJ = +330 kJ).
Learn more about enthalpy here:
https://brainly.com/question/3393755
#SPJ1
Based on molecular orbital theory, the only molecule in the list below that has unpaired electrons is ________.
Li2
N2
C2
F2
O2
The molecule that has unpaired electrons based on molecular orbital theory is O2.
What is Electron?
An electron is a subatomic particle with a negative charge that orbits the nucleus of an atom. Electrons have a mass of approximately 9.11 x[tex]10^{-31}[/tex]kilograms and a fundamental unit of charge, which is equal to -1.602 x [tex]10^{-19}[/tex]coulombs. Electrons are involved in chemical reactions and determine the chemical and physical properties of atoms and molecules. They are also involved in the production of electricity and are the basis of modern electronics.
Molecular orbital theory is a model used to explain the bonding of molecules. According to this theory, molecular orbitals are formed by the linear combination of atomic orbitals of the constituent atoms. These molecular orbitals can be bonding or antibonding in nature, and the number of electrons in the bonding and antibonding orbitals determines the stability and reactivity of the molecule.
Learn more about Electron from the given link
https://brainly.com/question/860094
#SPJ1
Under certain conditions the decomposition of ammonia on a metal surface gives the following data.
[NH3] (M) 3.0 ✕ 10−3 6.0 ✕ 10−3 9.0 ✕ 10−3
Rate (mol/L/h) 1.5 ✕ 10−6 1.5 ✕ 10−6 1.5 ✕ 10−6
(a)
Determine the rate equation for this reaction. (Rate expressions take the general form: rate = k . [A]a . [B]b.)
(b)
Determine the rate constant (in mol/L/h) using data from the first column.
WebAssign will check your answer for the correct number of significant figures.
mol/L/h
(c)
Determine the overall order for this reaction.
The given ammonia decomposition reaction on a metal surface is zero-order with respect to ammonia. The rate constant is [tex]1.5 × 10^-6[/tex] mol/L/h and the overall reaction order is zero.
(a) Since the rate remains constant while the concentration of ammonia changes, we can conclude that the reaction is zero-order with respect to ammonia. Therefore, the rate equation is:
rate = [tex]k[NH3]^0[/tex] = k
(b) Using data from the first column, we have:
rate = [tex]k[NH3]^0[/tex]
[tex]1.5 × 10^-6 mol/L/h = k(3.0 × 10^-3 M)^0[/tex]
k =[tex]1.5 × 10^-6[/tex] mol/L/h
(c) The overall order of the reaction is the sum of the orders with respect to each reactant. Since the reaction is zero-order with respect to ammonia, the overall order is zero.
Learn more about ammonia here:
https://brainly.com/question/14672082
#SPJ1
In this experiment, the pH curve is obtained for titration of a weak acid with a strong base. Sketch the pH curve expected for titration of a weak base with a strong acid.
When a weak base is titrated with a strong acid, the pH curve is expected to be the inverse of the curve obtained during the titration of a weak acid with a strong base.
Initially, the solution will have a high pH, which will gradually decrease as the acid is added. As the equivalence point is approached, the pH will rapidly decrease until it reaches a minimum value. At the equivalence point, the pH will be equal to 7. After the equivalence point, the pH will gradually increase as the excess acid is titrated by the base until it reaches a final high pH value.
Therefore, the pH curve expected for titration of a weak base with a strong acid will have a shape similar to the curve obtained for titration of a weak acid with a strong base, but inverted along the y-axis.
The pH curve for titration of a weak base with a strong acid is attached below.
What is base?According to the Arrhenius concept, base is defined as a substance which yields hydroxyl ions on dissociation.These ions react with the hydrogen ions of acids to produce salt in an acid-base reaction.
Bases have a pH higher than seven as they yield hydroxyl ions on dissociation.They are soapy in touch and have a bitter taste.According to the Lowry-Bronsted concept, base is defined as a substance which accepts protons .Base react violently with acids to produce salts .Aqueous solutions of bases can be used to conduct electricity .They can also be used as indicators in acid-base titrations.
They are used in the manufacture of soaps,paper, bleaching powder.Calcium hydroxide ,a base is used to clean sulfur dioxide gas while magnesium hydroxide can be used as an antacid to cure acidity.
Learn more about base,here:
https://brainly.com/question/13773045
#SPJ2
I NEED THIS DONE TODAY !!!!!!!!Electromagnetic Spectrum Lab Report
Destructions: In this virtual lab, you will use a virtual spectrometer to analyze astronomical
bodies in space. Record your hypothesis and spectrometric recular in the lab report below. You
will submit your completed report to your butructor.
Name and Title:
Include your name, instru
1
and name of lab.
Objectives (1):
In your own words, what is the purpose of this lab?
Hypothesis:
In this section, please include the predictions you developed during your lab activity. These
statements reflect your predicted outcomes for the experiment.
Procedure:
The materials and procedures are listed in your virtual lab. You do not need to repeat them here.
However, you should note if you experienced any errors or other factors that might affect your
outcome. Using your summary questions at the end of your virtual lab activity, please clearly
define the dependent and independent variables of the experiment.
Data:
Record the elements present in each unknown astronomical object. Be sure to indicate "yes" or
"no" for each element.
Hydrogen Helium Lithium Sodiam Carbon
Moon One
Moon Two
Planet One
Planet Two
Nitrogen
Conclusion:
Your conclusion will inchade a summary of the lab results and an interpretation of the results.
Please answer all questions in complete sentences using your own words.
1. Using two to three sentences, summarize what you investigated and observed in this lab
2. Astronomers use a wide variety of technology to explore space and the electromagnetic
spectrum; why do you believe it is essential to use many types of equipment when
studying space?
3. If carbon was the most common element found in the moons and planets, what element is
missing that would make them splat to Earth? Explain why. (Hint: Think about the
carbon cycle)
4.
We know that the electromagnetic spectrum uses wavelengths and frequencies to
determine a lot about outer space. How does it help us find out the make-up of stars?
5. Why might it be useful to determine the elements that a planet or moon is made up of?
PLEASE MAKE SURE YOU ANSWER THE HYPOTHESIS AND PROCEDURE QUESTION!!!!
Below contains the complete lab report on electromagnetic spectrum
The Lab ReportName: [Your Name]
Title: Electromagnetic Spectrum Lab Report
Instructor: [Instructor's Name]
Objectives:
The purpose of this lab is to analyze the elemental composition of different astronomical bodies using a virtual spectrometer and understand the importance of the electromagnetic spectrum in astronomical research.
Hypothesis:
I predict that the moons and planets will have varying compositions of elements, with hydrogen and helium being more common in gaseous bodies and heavier elements like carbon and nitrogen more common in rocky bodies.
Dependent variable: Presence of elements in astronomical bodies
Independent variable: Astronomical bodies (Moon One, Moon Two, Planet One, Planet Two)
Data:
[Please input your data for each object as per your virtual lab results]
Conclusion:
In this lab, I investigated the elemental composition of four different astronomical bodies using a virtual spectrometer and observed the presence or absence of various elements.
It is essential to use many types of equipment when studying space because different instruments can detect and analyze different aspects of the electromagnetic spectrum, providing a comprehensive understanding of the universe.
To make these moons and planets similar to Earth, oxygen would need to be present as it is a vital component of the carbon cycle and essential for life as we know it.
The electromagnetic spectrum helps us find out the makeup of stars by analyzing the emitted light, which contains information about the elements and their abundance within the star.
Determining the elements that a planet or moon is made up of helps us understand their formation, potential for life, and possible resources for future exploration or colonization.
Read more about Electromagnetic Spectrum Lab Report here:
https://brainly.com/question/30699255
#SPJ1
Select the two true statements about natural selection. Natural selection makes less advantageous variations become more advantageous over many generations. A population's environment affects the outcome of natural selection. Natural selection always makes a population gain new advantageous variations. Natural selection can change which variations are more common in a population over time. Submit
Answer:
The two true statements about natural selection are:
A population's environment affects the outcome of natural selection.
Natural selection can change which variations are more common in a population over time.
Natural selection acts on the existing variations within a population and favors those that confer a survival or reproductive advantage in a particular environment. Over time, the advantageous variations become more prevalent, and less advantageous ones may become less common or disappear from the population. However, natural selection does not necessarily create new variations; rather, it acts on the genetic variation that already exists within a population.
What is the normality of the solution that results when 4.0g of Al(NO3)3 (MW = 213.0) is dissolved in enough water to give 250mL of solution? What is the molarity of the solution?
the normality of the solution that results when 4.0g of Al(NO₃)₃ (MW = 213.0) is dissolved in enough water to give 250mL of solution the molarity of the solution is 0.0751 M.
To calculate the normality and molarity of the solution, we need to know the number of moles of Al(NO₃)₃ in the solution.
The number of moles can be calculated as:
moles = mass / molar mass
where mass is the mass of Al(NO₃)₃ and molar mass is the molecular weight of Al(NO₃)₃.
Substituting the given values, we get:
moles = 4.0 g / 213.0 g/mol = 0.01878 mol
The volume of the solution is given as 250 mL, which is equivalent to 0.25 L.
The normality of the solution is defined as the number of equivalents of solute per liter of solution. For Al(NO₃)₃, each mole of the compound produces 3 moles of ions, so the number of equivalents of Al(NO₃)₃ is:
equivalents = moles x 3
Substituting the value of moles, we get:
equivalents = 0.01878 mol x 3 = 0.05634 eq
The normality can now be calculated as:
normality = equivalents / volume
Substituting the given values, we get:
normality = 0.05634 eq / 0.25 L = 0.225 N
Therefore, the normality of the solution is 0.225 N.
The molarity of the solution is defined as the number of moles of solute per liter of solution. The number of moles of Al(NO₃)₃ in 250 mL of solution is the same as the number of moles in 1 L of solution, which is 0.01878 mol. Therefore, the molarity of the solution is:
molarity = moles / volume
Substituting the given values, we get:
molarity = 0.01878 mol / 0.25 L = 0.0751 M
Learn more about solution here:
https://brainly.com/question/30665317
#SPJ1
Question 1
Imagine yourself in the shoes of Dimitri Mendeleev. You are provided with two sets of cards that list properties of various
elements. These cards resemble the cards used by Mendeleev when he grouped elements. One set of cards lists the names
of known elements and their properties, while the other set of cards lists the properties of a few unknown elements. These
sets are shown below.
Known Elements Set
K
Physical State: solid
Density: 0.86 g/cm³
Conductivity: good
Physical State: solid
Density: 4.93 g/cm³
Conductivity: very poor
Solubility (H₂O): reacts rapidly Solubility (H₂O): negligible
Melting Point: 63°C
Melting Point: 113.5°C
Ge
Physical State: solid
Density: 5.32 g/cm³
Conductivity: fair
Solubility (H₂O): none
Melting Point: 937°C
CI
Ba
Physical State: solid
Density: 3.6 g/cm³
Conductivity: good
Au
Rb
Physical State: solid
Density: 19.3 g/cm³
Conductivity: excellent
Solubility (H₂O): None
Melting Point: 1064°℃
Physical State: gas
Density: 0.00178 g/cm³
Conductivity: none
Solubility (H₂O): reacts strongly Solubility (H₂O): negligible
Melting Point: 710°C
Melting Point: -189.2°C
Ag
Ar
A
For each of the following equilibria, write the equilibrium constant expression for Kc.
1. BaSO4(s) <---->Ba2+(aq) + SO42-(aq)
2. CH3COOH (aq) + H2O (l) <--->CH3COO- (aq) + H3O+ (aq)
Equilibria are chemical reactions that happen with a change in the concentration of the reactants or products. If the forward reaction is favored, a greater concentration of the product will be formed than the reactant(s), and the reaction is said to be favored. If the reverse reaction is favored, a greater concentration of the reactant(s) will be formed and thus the reaction is said to be favored. An equilibrium constant (constant K), is a number that describes the ratio of products to reactants at an equilibrium. K is also referred to as the equilibrium coefficient.
Answer:
1. Kc = [Ba2+][SO42-]
2. Kc = [CH3COO-][H3O+]/[CH3COOH]
Explanation:
The equilibrium constant expression for Kc is the product of the concentrations of the products raised to their stoichiometric coefficients divided by the product of the concentrations of the reactants raised to their stoichiometric coefficients.
1. For the first equilibrium, BaSO4(s) <---->Ba2+(aq) + SO42-(aq), the equilibrium constant expression for Kc is: Kc = [Ba2+][SO42-].
2. For the second equilibrium, CH3COOH (aq) + H2O (l) <—>CH3COO- (aq) + H3O+ (aq), the equilibrium constant expression for Kc is: Kc = [CH3COO-][H3O+]/[CH3COOH].
Note that the concentration of water is not included in the expression because it is a pure liquid and its concentration is considered constant.
A sample of helium occupies a volume of 160cm3 at 100 KPa and 25°c. what volume will it occupy if the pressure is adjusted to 80 KPa and the temperature remains unchanged?
Answer:
Explanation:Explore this page
About the gas laws calculator
This is an ideal gas law calculator which incorporates the Boyle's law , Charles's law, Avogadro's law and Gay Lussac's law into one easy to use tool you can use as a:
Boyle's Law-
[tex]\:\:\:\:\:\:\:\:\:\:\:\star\:\sf \underline{ P_1 \: V_1=P_2 \: V_2}\\[/tex]
(Pressure is inversely proportional to the volume)
Where-
[tex]\sf V_1[/tex] = Initial volume[tex]\sf V_2[/tex] = Final volume[tex]\sf P_1[/tex] = Initial pressure[tex]\sf P_2[/tex] = Final pressureAs per question, we are given that -
[tex]\sf V_1[/tex] = 160 cm³[tex]\sf P_1[/tex] = 100KPa[tex]\sf P_2[/tex] = 80KPaNow that we have all the required values and we are asked to find out that volume which will be occupied if the pressure is adjusted to 80 KPa and the temperature remains unchanged. For that we can put the values and solve for the final volume of helium-
[tex]\:\:\:\:\:\:\:\:\:\:\:\:\:\:\:\star\:\sf \underline{ P_1 \: V_1=P_2 \: V_2}[/tex]
[tex]\:\:\:\: \:\:\:\:\:\:\longrightarrow \sf 100 \times 160 = 80 \times V_2\\[/tex]
[tex] \:\:\:\:\:\:\:\:\:\:\longrightarrow \sf V_2 = \dfrac{100 \times 160}{80}\\[/tex]
[tex] \:\:\:\:\:\:\:\:\:\:\longrightarrow \sf V_2 =100\times \cancel{\dfrac{ 160}{80}}\\[/tex]
[tex]\:\:\:\: \:\:\:\:\:\:\longrightarrow \sf V_2 = 100 \times 2\\[/tex]
[tex] \:\:\:\:\:\:\:\:\:\:\longrightarrow \sf \underline{V_2 = 200 \:cm^3 }\\[/tex]
Therefore, 200 cm³ will be occupied if the pressure is adjusted to 80 KPa and the temperature remains unchanged.A 0.231 M solution of acetate has a pOH of 4.90. What is the Kb of acetate?
Explanation:
o solve this problem, we need to use the relation between pOH, pH, and the dissociation constant of the conjugate base of the weak acid, which is given by:
Kb = Kw / Ka
where Kb is the dissociation constant of the conjugate base, Ka is the dissociation constant of the weak acid, and Kw is the ion product constant of water, which is 1.0 x 10^-14 at 25°C.
First, we need to find the pH of the solution, since we know the pOH:
pH + pOH = 14
pH = 14 - 4.90 = 9.10
The weak acid in this case is the acetic acid (CH3COOH), which dissociates in water according to the equation:
CH3COOH + H2O ↔ CH3COO- + H3O+
The dissociation constant of acetic acid (Ka) is 1.8 x 10^-5 at 25°C. We can use this value and the relation between Ka and Kb to find Kb:
Kb = Kw / Ka = 1.0 x 10^-14 / 1.8 x 10^-5 = 5.56 x 10^-10
Therefore, the Kb of acetate is 5.56 x 10^-10.
Use Henry's law and the solubilities given below to calculate the total volume of nitrogen and oxygen gas
that should bubble out of 1.2 L of water upon warming from 25 * C to 50°C. Assume that the water is
initially saturated with nitrogen and oxygen gas at 25 °C and a total pressure of 1.0 atm. Assume that the
gas bubbles out at a temperature of 50 °C. The solubility of oxygen gas at 50°C is 27.8 mg/L at an
oxygen pressure of 1.00 atm. The solubility of nitrogen gas at 50° C is 14.6 mg/L at a nitrogen pressure
of 1.00 atm. Assume that the air above the water contains an oxygen partial pressure of 0.21 atm and a
nitrogen partial pressure of 0.78 atm
Express your answer using two significant figures.
Answer:
1. Use Henry’s law to find the initial concentrations of oxygen and nitrogen gas in water at 25°C. Henry’s law states that the concentration of a gas in a liquid is proportional to the partial pressure of the gas above the liquid. The proportionality constant is called the Henry’s law constant and it depends on the temperature and the nature of the gas and the liquid. The formula for Henry’s law is:
C = kP
where C is the concentration of the gas in the liquid, k is the Henry’s law constant, and P is the partial pressure of the gas.
The solubilities given in the problem are actually the values of k for oxygen and nitrogen gas at 50°C. To find the values of k at 25°C, we need to use a table or a graph that shows how k changes with temperature.
Using this table, we can estimate that k for oxygen at 25°C is about 40 mg/L/atm and k for nitrogen at 25°C is about 20 mg/L/atm.
Now we can plug in the values of k and P to find C for oxygen and nitrogen at 25°C:
C_O2 = k_O2 * P_O2 = 40 mg/L/atm * 0.21 atm = 8.4 mg/L C_N2 = k_N2 * P_N2 = 20 mg/L/atm * 0.78 atm = 15.6 mg/L
2. Use the ideal gas law to find the initial moles of oxygen and nitrogen gas in water at 25°C. The ideal gas law states that the pressure, volume, temperature, and moles of a gas are related by the formula:
PV = nRT
where P is the pressure, V is the volume, n is the moles, R is the universal gas constant, and T is the temperature.
We can rearrange this formula to solve for n:
n = PV/RT
We know that P is 1 atm, V is 1.2 L, R is 0.0821 Latm/molK, and T is 298 K (25°C + 273). We can plug in these values to find n for oxygen and nitrogen:
n_O2 = PV/RT = (1 atm * 1.2 L) / (0.0821 Latm/molK * 298 K) = 0.049 mol n_N2 = PV/RT = (1 atm * 1.2 L) / (0.0821 Latm/molK * 298 K) = 0.049 mol
However, these are not the actual moles of oxygen and nitrogen gas in water, because some of them are dissolved in water. To find the moles of dissolved gas, we need to use the concentration and the volume of water:
n_dissolved_O2 = C_O2 * V = (8.4 mg/L) * (1.2 L) / (1000 mg/g) / (32 g/mol) = 0.00032 mol n_dissolved_N2 = C_N2 * V = (15.6 mg/L) * (1.2 L) / (1000 mg/g) / (28 g/mol) = 0.00067 mol
To find the moles of gas that are not dissolved, we need to subtract the moles of dissolved gas from the total moles:
n_undissolved_O2 = n_O2 - n_dissolved_O2 = 0.049 mol - 0.00032 mol = 0.049 mol n_undissolved_N2 = n_N2 - n_dissolved_N2 = 0.049 mol - 0.00067 mol = 0.048 mol
3. Use Henry’s law again to find the final concentrations of oxygen and nitrogen gas in water at 50°C. We can use the same formula as before, but with different values of k and P:
C_O2 = k_O2 * P_O2 = 27.8 mg/L/atm * 0.21 atm = 5.8 mg/L C_N2 = k_N2 * P_N2 = 14.6 mg/L/atm * 0.78 atm = 11.4 mg/L
4. Use the ideal gas law again to find the final moles of oxygen and nitrogen gas in water at 50°C. We can use the same formula as before, but with different values of V and T:
n_O2 = PV/RT = (1 atm * 1.2 L) / (0.0821 Latm/molK * 323 K) = 0.045 mol n_N2 = PV/RT = (1 atm * 1.2 L) / (0.0821 Latm/molK * 323 K) = 0.045 mol
However, these are not the actual moles of oxygen and nitrogen gas in water, because some of them are dissolved in water. To find the moles of dissolved gas, we need to use the concentration and the volume of water:
n_dissolved_O2 = C_O2 * V = (5.8 mg/L) * (1.2 L) / (1000 mg/g) / (32 g/mol) = 0.00022 mol n_dissolved_N2 = C_N2 * V = (11.4 mg/L) * (1.2 L) / (1000 mg/g) / (28 g/mol) = 0.00049 mol
To find the moles of gas that are not dissolved, we need to subtract the moles of dissolved gas from the total moles:
n_undissolved_O2 = n_O2 - n_dissolved_O2 = 0.045 mol - 0.00022 mol = 0.045 mol n_undissolved_N2 = n_N2 - n_dissolved_N2 = 0.045 mol - 0.00049 mol = 0.044 mol
5. Use the ideal gas law one more time to find the final volume of oxygen and nitrogen gas that bubbles out of water at 50°C. We can use the same formula as before, but with different values of n and P:
V_O2 = nRT/P = (0.045 mol * 0.0821 Latm/molK * 323 K) / (1 atm) = 1.20 L V_N2 = nRT/P = (0.044 mol * 0.0821 Latm/molK * 323 K) / (1 atm) = 1.17 L
6. Add the volumes of oxygen and nitrogen gas to get the total volume of gas that bubbles out of water:
V_total = V_O2 + V_N2 = 1.20 L + 1.17 L = 2.37 L
Therefore, the total volume of nitrogen and oxygen gas that should bubble out of 1.2 L of water upon warming from 25°C to 50°C is 2.4 L using two significant figures.
Can you explain in detail how anion exchage occur in soil.
Answer:
With the adsorption of cations like zinc as Zn (OH)+ or ZnCl+ or both, the anion exchange is known to increase. The solid phase has an impact on the anions' concentration in the soil solution. Anions are negatively adsorbed as a result of the exchange complex's overall negative charge.
What Celsius temperature, T2 , is required to change the volume of the gas sample in Part A ( T1 = 19 ∘C , V1 = 1940 L ) to a volume of 3880 L ? Assume no change in pressure or the amount of gas in the balloon. Express your answer with the appropriate units.
T2 has a temperature of 58.6 °C in Celsius.
The International System of Units (SI) has two temperature scales: the Kelvin scale and the Celsius scale.In the Celsius scale, which was formerly known as the centigrade scale outside of Sweden, the degree Celsius is the unit of measurement for temperature. The ideal gas law, which asserts that PV = nRT, describes how a gas's temperature, pressure, and volume are related to one another.
Since the pressure and amount of gas in the balloon are assumed to be constant, we can rearrange the equation to solve for the temperature:
[tex]T2 = \frac{(PV1)}{(nRV2) }[/tex]
[tex]T2 =\frac{ (1 atm)(1940 L)}{(1 mol)(8.314 J/mol .K)(3880 L) }[/tex]
T2 = 58.6 ∘C
Therefore,The Celsius temperature, T2 is 58.6°C
learn more about ideal gas law Refer:brainly.com/question/28257995
#SPJ1
Predicting Products: Mg + K2SO4. (2 and 4 are coefficients)
The reaction between magnesium (Mg) and potassium sulfate (K2SO4) is a double displacement reaction that occurs in an aqueous solution. The products that will form depend on the solubility of the resulting compounds.
When Mg and K2SO4 react, magnesium sulfate (MgSO4) and potassium (K) will be produced. This is because the magnesium will displace the potassium ion in the potassium sulfate compound, resulting in the formation of magnesium sulfate and potassium metal.
The balanced chemical equation for this reaction is:
2Mg + K2SO4 → MgSO4 + 2K
It is important to note that this reaction will only occur if the magnesium is more reactive than the potassium in the solution. If the opposite were true, no reaction would occur.
To know more about double displacement reaction , visit:
https://brainly.com/question/29307794
#SPJ1
draw and explain the energy profile diagram along with various possible conformations of cyclohexane
Answer:
we're is the diagram I don't see it
The carbon cycle most affects which factor? Responses erosion erosion air quality air quality living organisms living organisms weather conditions
The carbon cycle most affects living organisms. Carbon is an essential element for life, as it is a major component of organic molecules such as carbohydrates, proteins, and fats.
The carbon cycle describes the movement of carbon between living and non-living components of the Earth's biosphere, including the atmosphere, oceans, and land. Through processes such as photosynthesis, respiration, decomposition, and combustion, carbon is exchanged between organisms and the environment, influencing the growth and survival of living organisms.
To know more about combustion please refer:
https://brainly.com/question/31123826
#SPJ1
Consider the following intermediate chemical equations.
2 equations: first: upper C (s) plus one-half upper O subscript 2 (g) right arrow upper C upper O (g). Second: upper C upper O (g) plus one-half upper O subscript 2 (g) right arrow upper C upper O subscript 2 (g).
When you form the final chemical equation, what should you do with CO?
The CO gas produced in the first equation is used in the second equation to produce CO2 in the final equation.
In the intermediate equations, solid carbon (C) and molecular oxygen (O2) are transformed into gaseous carbon monoxide (CO), which is then reacted with more oxygen to produce carbon dioxide (CO2).
The final chemical equation can be created by combining the intermediate equations and cancelling out the intermediate reactant and product (CO and O2) to obtain the overall balanced equation for the reaction:
C(g) + O2(s) = CO2 (g)
Thus, the CO generated in the first equation is consumed in the second equation and does not show up in the third and final equation. The two intermediate reactions' combined outcome is represented by the final equation, which only includes the reactants (C and O2) and product (CO2).
Learn more about molecular oxygen here:
https://brainly.com/question/11587330
#SPJ1
You are trying to increase the rate at which you can dissolve a large amount of sodium chloride into water to make a solution to use in lab.
Which of the following would be the BEST method of doing this?
A. stir and heat the mixture and use small pieces of sodium chloride
B. heat the water and use a large piece of sodium chloride
C. stir and heat the mixture and use a large piece of sodium chloride
D. heat the water and use small pieces of sodium chloride
Kelly wants to build a small koi fish pond in her back yard what natural material should she pine her pond with to make sure that no water leaks out the pond through gravitational water flow
Kelly should line her koi fish pond with clay to ensure that no water leaks out through gravitational water flow.
Building a koi fish pondClay is a natural material that is used widely in pond and water feature construction. It has excellent water-holding properties and is able to form a waterproof seal when properly installed. Clay liners can be formed using either bentonite clay or kaolin clay, both of which are readily available and relatively inexpensive.
When installing a clay liner, it is important to prepare the pond base by removing any sharp or protruding objects, compacting the soil, and smoothing out any irregularities. The clay liner can then be laid down in layers and compacted to ensure a uniform thickness and a solid seal.
Overall, using a clay liner is an effective way to prevent water from leaking out of a koi fish pond and to maintain a healthy environment for the fish.
More on fish ponds can be found here: https://brainly.com/question/29276248
#SPJ1
How many moles of argon are in 35.3 g of argon?
Answer: 0.883605 or 0.884
Explanation:
The molar mass of argon is equal to the average atomic mass given in the periodic table, 39.948 g/mol.
Use the molar mass as a conversion factor between mass and moles.
35.3 g×1 mol/39.948 g=0.884 mol
what are minerals?
explained
A mineral is a substance such as tin, salt, or sulphur that is formed naturally in rocks and in the earth. Minerals are additionally observed in small portions in food and drink.
Why are minerals important?Minerals are integral for three essential reasons: building robust bones and teeth. controlling physique fluids inside and outdoor cells. turning the meals you devour into energy.
Why are minerals so important?Minerals are necessary for your body to remain healthy. Your physique uses minerals for many one of a kind jobs, which include maintaining your bones, muscles, heart, and talent working properly. Minerals are additionally necessary for making enzymes and hormones. There are two types of minerals: macrominerals and hint minerals.
Learn more about minerals here;
https://brainly.com/question/15844293
#SPJ1