What is the solution to the equation 9(x + 2) = 27?

A. x = 2.5
B. x = 0.5
C. x = −0.5
D. x = −3.5

Answers

Answer 1
First distribute 9 to what is inside of the parentheses so…
9x+18=27
Then you would subtract 18 from 27
9x=9
After that divide 9 on both sides to get the X by itself

X=1

Related Questions

ILL BRAINLIEST YOU PLEASE HELP ME

Answers

Answer:

1.) 15

2.) 12.5

Step-by-step explanation:

Which is the equation of the given line?
x = 1 y = 2x y=x y=1 (need help ASAP)

Answers

Answer:

y = 1

Step-by-step explanation:

Since the line is a horizontal line through 1, y = 1.

Unit 1 geometry basics Homework 2
pls help! i’ll mark brainliest

Answers

The value of AB= 24 BD is congruent to BC. BD=BC

BD = 5x – 26, BC = 2x + 1, and AC = 43

How to find value of AB?From the diagram , AC=AB+BCTo find out , we need to find  BC first . For that we have to find out xWE know that BD=BC, using that we solve for x5X-26=2X+1SUBSTRACT 2X3X-26=1ADD 263x=27x=9Now we plug in 9 for x  and find out BCBC=2x+1BC=2(9)+1BC=19We know AC= 43AC=AB+BC43=AB+19subtract 19AB=24

To learn more about find value of AB refers to:

brainly.com/question/11923213

#SPJ1

use substitution to solve each system of equations

2. y= 4x+5
2x+y=17

6. 3x +4y= -3
x+2y= -1

8. -1=2x - y
8x-4y=-4

10. y= -4x + 11
3x + y=9

15. -5x+4y=20
10x-8y= -40

Answers

I think it's answer this .

How do you identify if a polynomial is a sum or difference of two cubes?

Answers

Identification if a polynomial is a sum or difference of two cubes can be done by factorizing the provided polynomial.

What is a polynomial?

A polynomial is a mathematical expression that is a sum of one or more terms. Each term is a constant or a variable raised to a non-negative integer power and multiplied by a coefficient. The degree of a polynomial is the highest degree of the terms in the expression. A polynomial with one variable is called a univariate polynomial, and a polynomial with more than one variable is called a multivariate polynomial. Polynomials are used in various areas of mathematics, physics, engineering, computer science, and other fields. They can be used to model a wide range of phenomena and to solve problems that involve polynomial equations or inequalities.

What do you mean by factorization?

Factorization, also known as factoring, is the process of breaking down a mathematical expression into a product of simpler factors. The goal is to express a given expression as a product of simpler expressions, which can be useful in solving equations and understanding the structure of the expression.

Factor the polynomial completely into its irreducible factors.

Look for terms that are of the form (x - a)^3 or (x + a)^3, where a is a constant. These are the cubes that you are looking for.

If there are two such terms, check if they can be combined into a single term by adding or subtracting them. If they can, then the polynomial is a sum or difference of two cubes.

If there are more than two such terms, check if any two of them can be combined in the same way. If they can, then the polynomial is a sum or difference of two cubes.

To learn more about polynomials visit:

https://brainly.com/question/11536910

#SPJ4

pls help with question image is linked

Answers

The kilogram of fruits sold each day are 135 kg, 110 kg and 70 kg

How to determine the amount sold each day

From the question, we have the following parameters that can be used in our computation:

Day 2 = Day 1 - 25

Day 3 = 2/7 * (Day 1 + Day 2)

Total weights = 315

Next, we use the following representations

x = Day 1, y = Day 2 and z = Day 3

So, we have the following equations

y = x - 25

z = 2/7(x + y)

x + y + z = 315

Substitute y = x - 25 in z = 2/7(x + y) and x + y + z = 315

z = 2/7(x + x - 25) = 2/7(2x - 25)

x + y + z = 315 ⇒ x + x - 25 + z = 315

So, we have

z = 2/7(2x - 25)

2x + z = 340

Substitute z = 2/7(2x - 25) in 2x + z = 340

2x + 2/7(2x - 25) = 340

So, we have

7x + 2x - 25 = 1190

Evaluate the like terms

9x = 1215

Divide by 9

x = 135

So, we have

y = x - 25 = 135 - 25 = 110

z = 2/7(x + y) = 2/7 *(135 + 110) = 70

Hence, the amounts are 135 kg, 110 kg and 70 kg

Read more about equations at

https://brainly.com/question/2972832

#SPJ1

Put the letters into the correct order to make worlds. Then match them to the definitions
oiffce psorin hlostipa ctotgae fcatyor gtues-hsoue

1. A room or building where people work at desks……..
2. A small hotel that is not very expensive………
3. A building where people are sent if they have committed a crime……..
4. A building where people go if they ill……..
5. A building where people make things, often using machines………
6. A small attractive house in the country……….

*************

1. A: Excuse me, can you tell me (1) the way to how far for the station?
B: Yes, sure. (2) Take/Turn left at the traffic lights and you'll see the station (3) in front / by
front of you.
2. A: Excuse me, (4) is it far / can you direct to the museum?
B: No. Just go (5) straight off / straight on for about half a kilometre and the museum is
(6) on / at your right.

Answers

Answer:

Step-by-step explanation:

A cereal box is designed to hold a volume of 4096 cubic centimetres of cereal.
What dimensions will minimize the cost of producing the box?

Answers

Answer:

Refer to the step-by-step

Step-by-step explanation:

To minimize the cost of producing the box, we would want the box to be a cube.

Where the volume, [tex]V=s^{3}[/tex], where s is the length of one side of the box.

We were given the value, [tex]V=4096 cm^{3}[/tex], plug this into the equation above so we can find the dimensions of the box...

[tex]4096=s^{3} = > s=\sqrt[3]{4096} = > s=16[/tex]

Thus the dimensions to minimize the cost of the production of the box would be 16cm by 16cm by 16cm.

If Claire bikes at an average speed of 7 miles per hour how many hours will it take her to ride 28 miles?

Answers

Answer:

4 hours

Step-by-step explanation:

28/7 = 4

Please help me asap!!

Answers

Answer:

D

Step-by-step explanation:

Greg has 14 as many songs on his computer as Mark. Raj has 6 fewer than 60% of the songs that Mark has. Mark has 720 songs on his computer.

Answers

Using percentage and equations, Greg has 734 songs, Raj has 426 songs and Mark has 720 songs

What is Percentage

Percentage is a way of expressing a number as a fraction of 100. It is often denoted using the percent symbol, "%". For example, 45% (read as "forty-five percent") is equal to 45/100, or 0.45. Percentages have no dimension, which it's why they are dimensionless number. for example 60% of a number, then it means 60 per cent of its whole.

In this problem, we can write an equations and solve to determine the number of songs Greg has on his computer.

Let;

x = number of songs Greg hasy = Number of songs Raj has

Since Mark has 720 songs in his computer;

x = 14 + 720

x = 734

Greg has 734 songs

We can calculate the number of songs Raj has by;

y = 60%(720) - 6

y = [(0.6) * 720] - 6

y = 426

Learn more on percentage here;

https://brainly.com/question/843074

#SPJ1

Level 3: What is the sum of the polynomials?
(-7x2 – 3x4 – 5) + (-3x4 +3+9x²)

Answers

Answer:

2x^2-6x^4-2

Step-by-step explanation:

Answer:

Remove parentheses.

−7x²−3[tex]x^{4}[/tex]−5−3[tex]x^{4}[/tex]+3+9x²

Add −7x² and 9x² .

2x²−3[tex]x^{4}[/tex]−5−3[tex]x^{4}[/tex]+3

Subtract 3[tex]x^{4}[/tex] from −3[tex]x^{4}[/tex].

2x²−6[tex]x^{4}[/tex]−5+3

Add −5 and 3.

2x²−6[tex]x^{4}[/tex]−2

Step-by-step explanation:

F(x)=2(x-3)squared it’s graphing and I forgot how to solve it

Answers

The solution of the function f(x) = 2(x - 3)² is at x = 3 as shown in the graph.

What is an equation?

An equation is used to show the relationship between numbers and variables.

Polynomial can be classified based on degree as linear, quadratic, cubic.

Given the function:

f(x) = 2(x - 3)²

The graph of f(x) is plotted. The solution of the graph can be gotten from its x intercept. Hence the solution is at x = 3

Find out more on equation at: https://brainly.com/question/2972832

#SPJ1

The factorization of a trinomial is modeled with algebra tiles.

An algebra tile configuration. 3 tiles are in the Factor 1 spot: 1 is labeled + x, 2 are labeled negative. 4 tiles are in the Factor 2 spot: 1 is labeled + x and 4 are labeled +. 12 tiles are in the Product spot: 1 is labeled + x squared, 2 are labeled negative x, the 3 tiles below + x squared are labeled + x, and the 6 tiles below the negative x tiles are labeled negative.
Which trinomial is factored?

x2 + 3x – 6
x2 + 5x – 6
x2 + 3x – 2
x2 + x – 6

Answers

Answer:

A.) x + 3 and x + 2

Step-by-step explanation:

The trinomial which is factored as described is; x² + x - 6.

Trinomial factorisation

According to the question;

Factor 1 spot: 1 is labeled + x, 2 are labeled negative.

(x -1 -1)

Factor 2 spot: 1 is labeled + x and 4 are labeled +.

x + 1 + 1 + 1

Product spot: 1 is labeled + x squared, 2 are labeled negative x, the 3 tiles below + x squared are labeled + x, and the 6 tiles below the negative x tiles are labeled negative.

x²-2x +3x -6

Hence, the product of the factors is therefore;

x² + x - 6.

From the description of the previous factors; the trinomial which is factored is; x² + x - 6.

Read more on trinomial factorisation;

https://brainly.com/question/25824273

A DVD player had a $108. Price tags the store gave a 25% discount. What was the amount of the discount?

Answers

Answer:

$27

Step-by-step explanation:

If we know that %25 is equal to 1/4, or 0.25, then we can use an equation that look like this:
108 × 0.25 = 27

Therefore, the amount of the discount was $27

How can you solve for percentages?

Solving for percentages can be tricky, and you may need help on trying to solve a problem including one. If you need to find a percentage of a number, the easiest way to do that is to convert the percentage into a fraction or decimal and multiply the total by that number.

For ex.

What is 15% of 60?

To do this, convert the percentage into a decimal.

15% converted into a decimal is 0.15.

Now multiply 60 by 0.15.

60 ÷ 0.15 = 9

So, the answer to this example would be 9.

Christina is planning on selling handmade blankets. She has 1,000 blankets to sell and expects the number of blankets sold to be 10 fewer than her total number of blankets for every $1 she

charges for a blanket. What is the equation

Answers

The equation is y = 1000 - 10x, where y is the number of blankets sold and x is the price in dollars.

This equation represents the relationship between the number of blankets sold (y) and the price of each blanket (x). The equation starts with the total number of blankets Christina has to sell (1000) and then subtracts 10 for every $1 increase in the price of the blanket. This means that as the price of the blanket increases, the number of blankets sold will decrease by 10 for every $1 increase. For example, if Christina charges $50 for a blanket, the number of blankets sold would be 500 (1000 - (10x50)).

Learn more about Equations here:

https://brainly.com/question/28871326

#SPJ4

Akira receives a price at a science fair for having the most informative project her trophy is in the shape of a square pyramid and is covered in shiny gold foil how much gold foll did it take to cover the trophy including the bottom ​

Answers

Answer:

216 cm^2

Step-by-step explanation:

HELP I NEED HELP ASAP HELP I NEED HELP ASAP HELP I NEED HELP ASAP HELP I NEED HELP ASAP
HELP I NEED HELP ASAP HELP I NEED HELP ASAP HELP I NEED HELP ASAP HELP I NEED HELP ASAP

Answers

Answer:

b

Step-by-step explanation:

The answer to it is B

In the diagram below, PQ is parallel to MN. If PQ, is 22 more than MP, PO=12, and MN=12, find the length of MP. Figures are not necessarily drawn to scale. State your answer in the simplest radical form, if necessary.

Answers

The measure of the length MP is equal to 6.

What are similar triangles?

Two triangles are similar triangles if they have the same corresponding angle measures and proportional side lengths.

Given is a triangle ΔOMN.

Now, ΔOMN and ΔOPQ are similar. This means that the side lengths are proportional to each other. We can write -

OP/OM = PQ/MN

12/OM = PQ/MN

12/(OP + PM) = PQ/MN

It is given that -

PQ = MP + 2

12/(OP + PM) = (MP + 2)/MN

12MN = (MP + 2)(OP + PM)

12 x 12 = (MP + 2)(MP + 12)

(MP)² + 12MP + 2MP + 24 = 144

(MP)² + 14(MP) - 120 = 0

Let MP = x, then we can write -

x² + 14x - 120 = 0

(x + 20)(x - 6) = 0

(x + 20) = 0   and    (x - 6) = 0

x = - 20   and   x = 6

x = 6      {Lengths cannot be negative}

Therefore, the measure of the length MP is equal to 6.

To solve more questions on similar triangles, visit the link below -

https://brainly.com/question/14926756

#SPJ1

What is the radius and diameter of the following circle

Answers

Answer:

r=4.2

d=9

Step-by-step explanation:

The radius is 4.2cm

The diameter is d=9

Solution

d=2r=2·4.5=9

Hope this helped!!!!!

PLEASE HELP: Given AC and BD bisect each other, prove that ΔABX≅ΔCDX using the SAS congruence theorem. ??

Answers

The ∆ABX and ∆CDX formed after the mutual bisection of AC and BD each other at point X are congruent i.e ΔABX ≅ ΔCDX, by SAS congruance theorem.

SAS congruence theorem: "SAS " stands for "Side-Angle-Side". If there is two sides and the angle between these two sides are congruent to the corresponding sides and angle of another triangle, then the two triangles are said to be congruent. We have , A Quadrilateral ABCD, such that AC and BD bisect each other at point X. After bisection there is formed 4 triangles. We have to show ΔABX ≅ ΔCDX by SAS Congruance Rule. Now, as we know that bisect point divides the sides into two equal parts, i.e, AX = CX and DX = BX. So, in ΔABX and ΔCDX

AX = CX ( since X is bisecter point )BX = DX ( from bisection )m∠AXB = m∠CXD ( corresponding angles)

As we see ∠AXB is angle in between to two sied AX and BX . Similarly, ∠CXD is in between CX and DX . So, by using SAS congruance theorem ∆ABX is congruent to ∆CDX i.e., ΔABX ≅ ΔCDX.

To learn more about SAS Congruance threoem, refer:

https://brainly.com/question/18922904

#SPJ4

Ellie ha been training for the Cedar Ridge Off-Road Race. The firt week he trained, he ran 3 day and took the ame two route each day: 2. 5 mile on a path in the wood in the morning and a longer route at the park in the afternoon. By the end of the week, Ellie had run a total of 24 mile. Which equation can you ue to find how many mile, x, Ellie ran each afternoon

Answers

The Distance that Ellie ran each evening is 16.5 miles for a entirety week.

How to find the number of miles?

We can use the following equation to find how many miles, x, Ellie ran each afternoon:

x + 2.5(3) = 24

Here, x represents the number of miles Ellie ran each afternoon, 2.5 represents the number of miles she ran each morning, and 3 represents the number of days she trained. The total number of miles she ran, 24, is on the right side of the equation.

To solve for x, we can start by simplifying the left side of the equation:

x + 7.5 = 24

Then, we can subtract 7.5 from both sides:

x = 16.5

So, Ellie ran 16.5 miles each afternoon.

To know more on equation at:

brainly.com/question/2972832

#SPJ4

Simplify (with steps please:))
√((x+c)^2 + y^2) = x*a/c + a

Answers

On solving the expression for (y), we get two possible values, one real and one complex as -

y = √{ (a²x²/c² + a² + 2a²x/c) - (x² + c² + 2xc)}    -- Real

y = i√{(a{x/c + 1})² + (x² + c² + 2xc)}    -- Complex

What is expression?In mathematics, an expression or mathematical expression is a finite combination of symbols that is well-formed according to rules that depend on the context.Mathematical symbols can designate numbers (constants), variables, operations, functions, brackets, punctuation, and grouping to help determine order of operations and other aspects of logical syntax.

Given is the expression as follows -

√{(x + c)² + y²} = x (a/c) + a

√{(x + c)² + y²} = xa/c + a

√{(x + c)² + y²} = a{x/c + 1}

√{x² + c² + 2xc + y²} = a{x/c + 1}

{x² + c² + 2xc + y²} = ± (a{x/c + 1})²

Now, we can write -

{x² + c² + 2xc + y²} = (a{x/c + 1})²              ...... (1)

and

{x² + c² + 2xc + y²} = - (a{x/c + 1})²                 ......... (2)

Solving (1) as -

{x² + c² + 2xc + y²} = (a{x/c + 1})²    

{x² + c² + 2xc + y²} = a²(x/c + 1)²

{x² + c² + 2xc + y²} = a²(x²/c² + 1 + 2x/c)

{x² + c² + 2xc + y²} = (a²x²/c² + a² + 2a²x/c)

y² = (a²x²/c² + a² + 2a²x/c) - (x² + c² + 2xc)

y = √{ (a²x²/c² + a² + 2a²x/c) - (x² + c² + 2xc)}

Solving (2) as -

{x² + c² + 2xc + y²} = - (a{x/c + 1})²                

y² =  - (a{x/c + 1})² - (x² + c² + 2xc)

y² = - {(a{x/c + 1})² + (x² + c² + 2xc)}

y = √- {(a{x/c + 1})² + (x² + c² + 2xc)}

y = i√{(a{x/c + 1})² + (x² + c² + 2xc)}

Therefore, on solving the expression for (y), we get two possible values, one real and one complex as -

y = √{ (a²x²/c² + a² + 2a²x/c) - (x² + c² + 2xc)}    -- Real

y = i√{(a{x/c + 1})² + (x² + c² + 2xc)}    -- Complex

To solve more questions on expression evaluation, visit the link below -

brainly.com/question/1041084

#SPJ1

HELP BRAINLIEST FOR FASTEST AND CORRECT NO NEED TO EXPLAIN

Answers

Answer:

The answer is 48

Step-by-step explanation:

Answer:

48 students

4*12=48

In store the ratio of blue shirts to red shirts is 2:5. If there is 100 red shirts in the store, how many blue shirts are there?

Answers

The ratio of blue shirts to red shirts is 2:5, so for every five red shirts, there are two blue shirts.

What is ratio?

Ratio is a mathematical term used to compare two different values. It is a way of expressing one quantity in relation to another. Ratios can be written as fractions, decimals, or percentages. Ratios are used in many different areas, such as finance, economics, science, and engineering. Ratios are also used to compare the size, speed, or cost of different items. Ratios can be used to compare parts of a whole, or to compare different items within a group.

Since there are 100 red shirts in the store, there are 40 blue shirts in the store (100 / 5 x 2 = 40).

To know more about ratio click-
https://brainly.com/question/25927869
#SPJ1

At the toy store, 4 toy cars cost $3.84. How much does it cost to buy 20 toy cars?

A. $20.20

B. $17.20

C. $19.20

D. $21.20

Whoever gets the correct answer will get a crown!!!

Answers

Step-by-step explanation:

To answer this, we need to find the scale factor which is to find how much one individual car is worth.

So we need to divide 3.84 and 4.

3.84 ÷ 4 = 0.96

So each car is $0.96.

To find 20 toy cars, we need to multiply 0.96 and 20.

The answer is:

$19.20

the answer is C. Since you already know 4 is 3.84(and 4x5=20) so you multiply 3.85x5=19.20

Describe the transformation from the red figure to the blue figure.

The blue figure is translated ____ units ____ and ____ units ____ from the red figure.

Answers

Step-by-step explanation:

The blue figure is translated 2 units down and 6 units across from the red figure.

Please help me on this :/

Answers

Answer

8. b

9.C

10.a

11.a

12. c

13. b

brainliest pls <3

This is algebra 2, please help.

Answers

The vertex and axis of symmetry of the graph is shown in image.

What is an expression?

Mathematical expression is defined as the collection of the numbers variables and functions by using operations like addition, subtraction, multiplication, and division.

Given that;

The function is,

⇒ f (x) = 1/4 (x + 6)² - 5

Now,

Since, The function is,

⇒ f (x) = 1/4 (x + 6)² - 5

Hence, The points corresponds to x = - 2 and - 4 are;

For x = - 2;

⇒ f (x) = 1/4 (x + 6)² - 5

⇒ f (x) = 1/4 (-2 + 6)² - 5

⇒ f (x) = 1/4 (4)² - 5

⇒ f (x) = 4 - 5

⇒ f (x) = - 1

For x = - 4;

⇒ f (x) = 1/4 (x + 6)² - 5

⇒ f (x) = 1/4 (-4 + 6)² - 5

⇒ f (x) = 1/4 (2)² - 5

⇒ f (x) = 1 - 5

⇒ f (x) = - 4

Thus, The points are;

⇒ (- 2, - 1) , (- 4, - 4)

And, The vertex of the function is,

⇒ ( - 6, - 5 )

And, The axis of symmetry of the graph is,

⇒ x = - 6

Learn more about the mathematical expression visit:

brainly.com/question/1859113

#SPJ1

The first 5 terms of a certain sequence are 6. 12, 24, 48, and 96.
Which two statements about this sequence are true?
This is a geometric sequence.
This is an arithmetic sequence.
The function f(n)2(6)"
The function f(7) = 6(2)"
The function f(n) = 6 -6(n
represetits this sequence, where is a positive whole
represents this sequence, where is a positive whole r
1) represents this sequence, where n is a positive wh

Answers

Answer:

see explanation

Step-by-step explanation:

there is a common ratio between consecutive terms, that is

12 ÷ 6 = 24 ÷ 12 = 48 ÷ 24 = 96 ÷ 48 = 2

this indicates the sequence is geometric

the nth term of a geometric sequence is

f(n) = a₁ [tex](r)^{n-1}[/tex]

where a₁ is the first term and r the common ratio

here a₁ = 6 and r = 2 , then

f(n) = 6 [tex](2)^{n-1}[/tex]

Other Questions
Is N2 equal to Avogadro's number? help me pls the question is in the picture Help on #8 only please thank you ! 3.What methods are you using to test this hypothesis?Outline the steps of the procedure in full sentences. Natural selection What is ricin? What are the differences between ricin and anthrax? How was Parliament formed? If you help me, I shall be your friend! :)PLEASE HELP ME!!!For each equation below, decide what value, if any, would make it true.( Please no links, and don't answer unless you're actually going to help me) What is the sum of the positive integers that are solutions of -3n +3 >-11? which products are purchased only after customer have compared a variety of similar and competitive products What are your thoughts as we approach Memorial Day? How to you spend Memorial day? A team in control of the ball in its front court cannot maintain or regain possession of the ball if it enters the back court, unless a defensive player has touched it. This is called: Explain the processes involved when drugs such as cocaine, marijuana, mescaline or alcohol enter the brain. 1: Find the total cost of 25 pens and 75 booksif each pen costs GH0.20 and each bookcosts GH0.30.ITI at a local cafeteria there are 10 vegetable selections available how many three vegetable plates maybe made In a certain city, the mean household annual income is $45,000 with a standard deviation of $6,000.Suppose a certain household has an annual income with a z-score of 1.5. What is their annual income? A food factory makes 560 fans in 7 days with the help of 20 machines,how many fans will be made in 12 days with the help of 18 machines. Giving away 700 points total every 30 seconds stay tuned #6 What are three things kracha valued most? in the book out of this furnace. a good marketing policy helps in promotion of trade. Explain Bro I have a headachee helppp and I need to go to sleep its so late