Consider the following intermediate chemical equations.

2 equations: first: upper C (s) plus one-half upper O subscript 2 (g) right arrow upper C upper O (g). Second: upper C upper O (g) plus one-half upper O subscript 2 (g) right arrow upper C upper O subscript 2 (g).

When you form the final chemical equation, what should you do with CO?

Answers

Answer 1

The CO gas produced in the first equation is used in the second equation to produce CO2 in the final equation.

In the intermediate equations, solid carbon (C) and molecular oxygen (O2) are transformed into gaseous carbon monoxide (CO), which is then reacted with more oxygen to produce carbon dioxide (CO2).

The final chemical equation can be created by combining the intermediate equations and cancelling out the intermediate reactant and product (CO and O2) to obtain the overall balanced equation for the reaction:

C(g) + O2(s) = CO2 (g)

Thus, the CO generated in the first equation is consumed in the second equation and does not show up in the third and final equation. The two intermediate reactions' combined outcome is represented by the final equation, which only includes the reactants (C and O2) and product (CO2).

Learn more about molecular oxygen here:

https://brainly.com/question/11587330

#SPJ1


Related Questions

You just worked on collecting evidence to answer the Investigation Question: How is something different when it is warmer or cooler? How did the experiment with the cold and warm water change your thinking about the Investigation Question?​

Answers

My experiment with the cold and warm water changed my thinking about the Investigation Question because it showed me that the temperature of something can have a major impact on its properties.

Experiment with cold and warm water

For example, warm water was more buoyant than cold water, which meant that the warmer water was able to float objects that the colder water could not. This showed me that temperature can play a role in the physical properties of an object, making it either lighter or heavier, depending on the temperature.

My experiment with cold and warm water showed me that temperature can have a major effect on physical properties. When comparing cold and warm water, I found that the warmer water was more buoyant and was able to float objects that the colder water could not.

This demonstrated to me how temperature can impact the weight and buoyancy of an object, making it either lighter or heavier depending on the temperature.

Learn more Experiment here:

https://brainly.com/question/17274244

#SPJ1

how many grams of no gas are there in a 5.00-l cylinder at 4.00 × 103 mm hg and 23°c

Answers

There are 32.1 grams of NO gas in the cylinder if a 5.00-l cylinder at 4.00 × 103 mm hg and 23°c.

To determine the number of grams of NO gas in a 5.00 L cylinder at [tex]4.00 × 10^3[/tex] mmHg and 23°C, we can use the ideal gas law:

PV = nRT

where P is the pressure, V is the volume, n is the number of moles of gas, R is the gas constant, and T is the temperature in Kelvin.

First, we need to convert the pressure to atmospheres and the temperature to Kelvin:

4.00 × [tex]10^3[/tex] mmHg = 5.26 atm (1 atm = 760 mmHg)

23°C = 296 K

Now we can rearrange the ideal gas law to solve for n:

n = PV/RT

n = (5.26 atm)(5.00 L)/(0.0821 L·atm/mol·K)(296 K) = 1.07 mol

Finally, we can convert from moles to grams using the molar mass of NO:

1.07 mol NO × 30.01 g/mol = 32.1 g NO

Therefore, there are 32.1 grams of NO gas in the cylinder.

Learn more about ideal gas law here

https://brainly.com/question/28257995

#SPJ1

write a brief statement that refers to the purpose of the experiment

Purpose: To find Heat of Solution of sodium hydroxide and to find the heat of neutralization between sodium hydroxide and hydrochloric acid, using enthalpy, Qsurr & Qrxn, percent error, etc.

experiment 1 findings:
50mL water
2.00g of sodium hydroxide
T (temp) initial = 20 degrees C
T (temp) final = 28.5 degrees C

experiment 2 findings:
50mL of 0.75 concentration M HCl
T (temp) initial = 23.5 degrees C
T (temp) final = 27 degrees C

Answers

The experiment involved measuring the temperature changes of water and solutions containing sodium hydroxide and hydrochloric acid.

What is HCl?

HCl is the chemical formula for hydrogen chloride, a colorless, highly pungent gas. It is a strong acid that is commonly used in industry for a variety of applications, such as the production of PVC, food processing, and metal cleaning. It is also found naturally in the stomach as a component of gastric acid, where it aids in digestion. In water, HCl dissociates into H+ and Cl- ions, making it a strong electrolyte.

The purpose of the experiment was to determine the heat of solution of sodium hydroxide and the heat of neutralization between sodium hydroxide and hydrochloric acid, using various methods such as enthalpy, Qsurr & Qrxn, percent error, etc.

Learn more about HCl from the given link

https://brainly.com/question/27576431

#SPJ1

Tom would like to really improve his typing skills, but he has soccer practice and rocket club and also likes to play video games with his friends, so he only practices once a week. What does Tom need to do to improve his skills?

Question 1 options:

invest more time in consistent practice


learn more shortcuts


get a better keyboard


quit all his other activities

Answers

Answer: invest more time in consistent practice

Explanation:

6. Which substance is soluble in water?
A. Pb(CO3)2
B. Ag3PO4
C. Sn(CrO4)2
D. NH4CI

Answers

Substance is soluble in water is D. NH₄CI. Soluble in water means that is capable of dissolving in water.

What does soluble in water mean?

Substance is soluble if it dissolves in certain fluids and the fluid [gas or liquid] (present in excess) is called solvent and substance dissolved in it is called solute which together forms solution. Process of dissolving is called the solvation.

If substance is soluble, then it implies that it can be dissolved in liquid. This means particles are broken down to become so small that we can no longer see them. Salt and sugar are examples of soluble materials. Opposite of soluble is insoluble ( that is a substance that cannot be dissolved).

To know more about soluble, refer

https://brainly.com/question/23946616

#SPJ1

describe the composition of baking powder and explain the part it plays in the baking industry

Answers

Baking powder is a mixture of sodium bicarbonate, other bicarbonates, and acid salts. Baking powder is a leavening agent produced by the mixture of an acid reacting with an alkali reacting one. These baking acids are tartrate, phosphate, and sodium aluminium sulphate, used alone or in combination.

Hope this helps!

A doctor orders 7 mg of compazine, which is used to treat nausea, vertigo, and migraine headaches. If the stock solution is 2.5 % (m/v), how many milliliters are administered to the patient?

Answers

To solve the problem, we need to use the following formula:

Amount (in mg) = concentration (in %) x volume (in mL) x density (in g/mL)

First, we need to convert the percentage concentration to a decimal:

2.5% = 0.025

Next, we can rearrange the formula to solve for volume:

Volume (in mL) = Amount (in mg) / (concentration (in %) x density (in g/mL))

The density of compazine is approximately 1 g/mL.

So, plugging in the given values, we get:

Volume (in mL) = 7 mg / (0.025 x 1 g/mL) = 280 mL

Therefore, 280 mL of the compazine solution should be administered to the patient.

Need help with problem

Answers

The number of moles of CO in the given conditions is 2.51 moles. To calculate the number of moles of CO in the given conditions, we need to use the Ideal Gas Law equation:

PV = nRT

Where:

P = pressure

V = volume

n = number of moles

R = gas constant

T = temperature

First, we need to convert the given temperature in Celsius to Kelvin by adding 273.15:

T = 93°C + 273.15 = 366.15 K

Now we can plug in the values we have:

P = 4.52 atm

V = 20.0 L

R = 0.0821 L.atm/mol.K (gas constant for CO)

T = 366.15 K

n = PV/RT = (4.52 atm x 20.0 L)/(0.0821 L.atm/mol.K x 366.15 K) = 2.51 moles

Therefore, the number of moles of CO in the given conditions is 2.51 moles.

To know more about Ideal Gas Law, visit:

https://brainly.com/question/28257995

#SPJ1

ASAP!!!!1. Claim: How are elements arranged on the periodic table in terms of valence
electrons?

Answers

Elements on the periodic table are arranged in order of increasing atomic number.

Arrangement of element in the Periodic table

This means that elements with lower atomic numbers have fewer valence electrons compared to elements with higher atomic numbers.

The elements are arranged into columns, or groups, based on the number of valence electrons they possess.

Elements in the same group generally have the same number of valence electrons, and elements in the same period (row) generally have one more valence electron than the element before it.

Learn more about the Periodic table here:

https://brainly.com/question/1173237

#SPJ1

We wish to determine the moles of carbon dioxide
produced when 50.0 mL of 2.0 M hydrochloric
acid reacts with excess sodium carbonate.
2HCl(aq) + Na₂CO3(aq) → 2NaCl(aq) + H₂O(1) + CO₂(g)
->
In the previous step, you determined
0.10 mol HCI react.
How many moles of carbon dioxide form during
the reaction?
Moles CO₂
Enter

Answers

Answer: .05

Explanation:

Round your answer to the nearest hundredth.
A right triangle A B C. Angle A C B is a right angle. Angle A B C is twenty degrees. Side B C is unknown. Side A C is four units.

Answers

The length of the side BC in the right triangle is 3.76 units.

How to find the length of side BC?

We want to find the length of the side BC, for the right triangle ABC.

We know that:

ACB = 90°

ABC = 20°

AC = 4 units.

Now we need to use trigonometric relations to find BC, we can use the relation:

cos(a) = adjacent cathetus/hypotenuse

Replacing what we know we will get:

cos(20°) =BC/4

4*cos(20°) = BC = 3.76

That is the length.

Learn more about right triangles at:

https://brainly.com/question/2217700

#SPJ1

Silicon nitride is a very hard, high-temperature-
resistant ceramic used as a component of
turbine blades in jet engines. It is prepared
according to the following equation:
3Si(s) + 2N₂(g) → Si3 N4(S)
Which is the limiting reactant when 2.00 g of Si
and 1.50 g of N₂ react?

Answers

The limiting reactant when 2.00 g of Si and 1.50 g of N₂ react is Silicon (Si).

When two reactive compounds are mixed, then they react according to the stoichiometry of the balanced chemical equation between them. The reactant which is present in excess will be left unreacted after the completion of the reaction whereas the other corresponding reactant will name as the limiting reagent of the reaction.  

The molar mass of Si and N₂ is 28.08 g/mol and 28 g/mol.

The stoichiometry in which Si and N₂ is 3:2.

The mass of Si required to react with 1.50 g of N₂ is calculated as follows:

m(Si) = (3 × 28.08 g) / (2×28 g) × 1.50 g = 2.25 g

Since the calculated mass of Si is more than the given mass. Therefore we can say that Si is a limiting reagent.

Learn more about limiting reagent from the link given below.

https://brainly.com/question/11848702

#SPJ1

Balanced chemicsl equation CuSO4 + Na2SO4

Answers

Since Na2SO4 + 2CuSO4 = 2NaSO4 + Cu2SO4 has an equal number of each element in its reactants and products, the equation is balanced.

What is the reaction's balanced chemical equation?

A chemical equation that is balanced has the same number of each type of atom on both sides of the equation. Subscripts are a component of the chemical formulas for the reactants and products that show how many atoms of the previous element there are in each.

What constitutes balancing a chemical equation in four steps?

Count the atoms on each side first. Next, alter one of the compounds' coefficients. Finally, count the atoms once more, and then repeat steps two and three until the equation is balanced.

To learn more about balanced chemical equations visit:

brainly.com/question/28294176

#SPJ1

What is the final volume of NaOH solution prepared from 250.0 mL of 0.300 M NaOH if you wanted the final concentration to be 0.150 M ?

Answers

The final volume of the NaOH solution is 500.0 mL.

To prepare a solution with a desired concentration, we can use the formula:

C = n/V

where C is the concentration in units of moles per liter (M), n is the number of moles of solute, and V is the volume of the solution in liters. Rearranging this formula, we get:

n = C x V

This formula tells us that we can find the number of moles of solute we need by multiplying the desired concentration (C) by the desired volume (V) of the solution.

To calculate the final volume of the NaOH solution, we can use the following equation:

M1V1 = M2V2

where M1 and V1 are the initial concentration and volume, respectively, and M2 and V2 are the final concentration and volume, respectively.

Substituting the given values into the equation, we get:

(0.300 M) (250.0 mL) = (0.150 M) (V2)

Solving for V2, we get:

V2 = (0.300 M × 250.0 mL) / (0.150 M)

V2 = 500.0 mL.

Learn more about concentration here:

https://brainly.com/question/10725862

#SPJ1

Drag each label to the correct location on the chart.
Sort the activities based on whether they decrease or maintain biodiversity.
planting more trees
excessive mining to
obtain minerals
releasing sewage
water into lakes
prohibiting fishing
during breeding
season
Reset Next

Answers

Reduce biodiversity: dumping sewage water into lakes as a result of excessive mining for minerals. Increase tree planting and ban fishing during the mating season to preserve biodiversity.

What steps may be taken to preserve biodiversity?

Encourage regional and local initiatives to combat biodiversity loss and promote its prevention. acquiring fewer products while ensuring that the ones you do purchase have a minimal impact on biodiversity. Investing in initiatives to advance biodiversity. Reducing waste of consumer products, including food, clothing, electrical equipment, and others can help to prevent the loss of biodiversity.

What examples of biodiversity are there?

The majority of people understand biodiversity as a collection of distinct living things that are capable of breeding with one another. Examples of species include white-tailed deer, blue whales, sunflowers, white pine trees, and microscopic germs that are so small they cannot even be seen with the human eye.

To learn more about biodiversity visit:

brainly.com/question/13073382

#SPJ1

If you are given 5 moles of NaNO, how many moles of HNO, would be produced?​

Answers

5 Moles of HNO₂ is produced from 5 moles of NaNO. This is taken out by molar reaction and stochiometric coefficients .

What are moles ?

A mole, like all units, must be defined or founded on something reproducible. The mole's current definition is defined, but it was previously based on the amount of atoms in a sample of the isotope carbon-12. A mole is now defined as Avogadro's number of elements, which is 6.02214076 × 10²³. For all practical purposes, one mole of a compound in grams is roughly equivalent to one molecule of the compound in Daltons.

Originally, a mole was defined as the amount of anything that contains the same number of elements as 12.000 grams of carbon-12. That number of elements is known as Avogadro's Number, which is approximately 6.02x10²³. 6.02x10²³carbon atoms constitute a mole.

Since the reaction of NaNO and HNO₂ is a 1:1 ratio, 5 moles of NaNO would produce 5 moles of HNO₂.

NaNO + HNO₂ → NaNO₂

The balanced equation for the reaction is:

2 NaNO + HNO₂ → 2 NaNO2

Therefore, if you start with 5 moles of NaNO, 5 moles of HNO₂ will be produced.

To know more about mole , visit ;

brainly.com/question/26416088

#SPJ1

Calculate the final volume of a baloon If It has a volume of 2.0L and pressure of 2 atmosphere and the pressure is reduced to I atmospher 1,Assume temperature remains​

Answers

Answer: 4 L

Explanation:

Boyle's law states that [tex]P_1V_1=P_2V_2[/tex]

Since no values other than pressure and volume change, we will use this equation.

Given in the problem we know:

[tex]P_1=2\\V_1=2.0\\P_2=1[/tex]

So, we are left with one variable to solve for.

[tex]2*2.0=1*V_2\\V_2=4 L[/tex]

What is the pH of a solution with an H+ ion concentration of 2.5e-4?

Answers

Answer: pH=-log[H+]

pH=-log(2.5x10^-4)

pH=3.6

Explanation:

What is the average experimental volume per mole of carbon dioxide calculated for sodium carbonate and sodium bicarbonate?

Answers

Answer: 24.356L/mol.

Explanation: Hence, the average experimental volume per mole of carbon dioxide for sodium carbonate and sodium bicarbonate is 24.356L/mol.

Write the formula of the hemiacetal
product when
CH3-CH₂-CH₂-CH₂-CHO
reacts with CH₂CH₂OH. Also, write the
acetal product.

Answers

When CH3-CH2-CH2-CH2-CHO (butyraldehyde) reacts with CH2CH2OH (ethylene glycol), a hemiacetal is formed.

The reaction can be written as:

CH3-CH2-CH2-CH2-CHO + CH2CH2OH → CH3-CH2-CH(OH)-CH2-CH2OH

The hemiacetal product is CH3-CH2-CH(OH)-CH2-CH2OH.

If the reaction continues, a second molecule of ethylene glycol can react with the hemiacetal to form an acetal:

CH3-CH2-CH(OH)-CH2-CH2OH + CH2CH2OH → CH3-CH2-CH(OC2H4)-CH2-CH2OH + H2O

The acetal product is CH3-CH2-CH(OC2H4)-CH2-CH2OH.

What is a molecule ?

Molecules can exist in different states, including gases, liquids, and solids. The physical and chemical properties of a molecule are determined by the types of atoms it contains, the way the atoms are arranged, and the types of chemical bonds between them. The study of molecules and their properties is an important area of chemistry and plays a crucial role in many areas of science and technology, including materials science, pharmaceuticals, and biochemistry.

To know more about Molecules visit :

https://brainly.com/question/19922822

#SPJ1

ASAP PLEASE!!!2. Evidence: Use the Element symbol provided to create a Bohr/ Orbital Model for
each. Use the PhET simulation to work through each. Complete the table below.
Include a picture of each that you either snip from the simulation or draw. Include the
I
Physical Science B 11-1C Lab Periodic Trends
information to complete the last 3 columns. Use the simulation for subatomic particles
and location. Use the periodic table to determine if it is a metal, nonmetal or metalloid.
The highlighted boxes have been done for you as examples.
(4 points)

Answers

Be is a metalB is a metalloidC is a non metal.

How do you know metal, nonmetal or metalloid in the periodic table?

Metals are typically solid at room temperature, have a shiny or metallic appearance, are good conductors of heat and electricity, and are malleable and ductile.

Nonmetals, on the other hand, can exist in all three states of matter at room temperature, are generally not shiny, and are poor conductors of heat and electricity. They tend to be brittle and cannot be easily drawn into wires or hammered into thin sheets.

Metalloids have properties that fall somewhere between those of metals and nonmetals. They may have a shiny or dull appearance, and their ability to conduct heat and electricity is generally between that of metals and nonmetals.

The position of an element in the periodic table can give you some clues about its classification. Metals are typically found on the left side and middle of the periodic table, nonmetals are found on the right side, and metalloids are located along the "stair-step" line that separates the metals and nonmetals.

Learn more about periodic table:https://brainly.com/question/11155928

#SPJ1

to lower the impacts of climate change we can do the following activities:

1
2
3
4
5
science plss help

Answers

Answer:

1. Know your carbon footprint.

2. Travel less.

3. Eat less meat and focus on sustainably grown meat.

4. Create less waste.

5. Recycle more and create less trash.

Aspirin is produced by the reaction of salicylic acid (M = 138.1 g/mol) and acetic anhydride (M = 102.1 g/mol).
C7H6O3(s) + C4H6O3() → C9H8O4(s) + C2H4O2()
If the theoritical yield of aspirin is 3.95 g and the actual yield is 2.04 g what is the percent yield?

Answers

The percent yield of aspirin is 51.6%.

What is the theoretical yield of aspirin in grams, given the reaction produced 10.0 g of salicylic acid and 5.0 g of acetic anhydride?

The limiting reagent is salicylic acid, and the theoretical yield of aspirin is 12.2 g.

If the actual yield of aspirin in the above scenario is 8.9 g, what is the percent yield?

The percent yield of aspirin is 72.9%.

The theoretical yield of aspirin is 3.95 g, but the actual yield is 2.04 g.

The percent yield can be calculated using the formula:

percent yield = (actual yield / theoretical yield) x 100%

Substituting the values given in the question, we get:

percent yield = (2.04 g / 3.95 g) x 100%

percent yield = 51.6%

Learn more about aspirin here:

https://brainly.com/question/13494090

#SPJ1

The flask contains 10.0 mL of HCl and a few drops of phenolphthalein indicator. The buret contains 0.140 M NaOH. It requires 13.5 mL of the NaOH solution to reach the endpoint of the titration. A buret filled with a titrant is held above a graduated cylinder containing an analyte solution.

What is the initial concentration of HCl?

concentration:............................M HCl

Answers

Answer:

To calculate the initial concentration of HCl, we can use the following formula: M1V1 = M2V2 where M1 is the initial concentration of HCl, V1 is the volume of HCl used in the titration (10.0 mL), M2 is the concentration of NaOH (0.140 M), and V2 is the volume of NaOH used to reach the endpoint of the titration (13.5 mL). Rearranging the formula to solve for M1, we get: M1 = (M2V2) / V1 Substituting the given values, we get: M1 = (0.140 M)(13.5 mL) / 10.0 mL M1 = 0.189 M Therefore, the initial concentration of HCl is 0.189 M.

7. A 10.0 gram sample of copper (C=0.383 J/g °C) is heated to 90°C and placed in 120 mL
of water at 20°C. Assuming no heat is lost to the container or the air, determine the
final temperature of the water.

Answers

The final temperature of the water is 28.9°C for the given copper rod,  assuming no heat is lost to the container or the air.

What is temperature ?

Temperature, a measure of hotness or coldness expressed in terms of any of several arbitrary scales and showing the direction in which heat energy will naturally flow—that is, from a hotter (higher) body to a colder body. (one at a lower temperature). Temperature is not the equivalent of a thermodynamic system's energy; for example, a burning match is much hotter than an iceberg, but the total heat energy contained in an iceberg is much larger than the energy contained in a match. Temperature, like pressure or density, is referred to as an intensive property—one that is independent of the quantity of substance under consideration—as opposed to extensive properties such as mass or volume.

The final temperature of the water can be calculated using the equation Q = mcΔT,

where Q is the heat energy,

m is the mass of the sample,

c is the specific heat capacity of the sample,

and ΔT is the temperature difference between the sample and the water.

Q = (10.0 g) ×(0.383 J/g °C) ×(90°C -20°C)

 = 2647 J

The equation Q = mcΔT can be rearranged to ΔT = Q/mc.

Applying this to the given scenario:

ΔT = [tex]\frac{2647 J}{120mL}[/tex] × (4.18 J/g·°C)

 = 8.9°C

Therefore, the final temperature of the water would be 28.9°C.

To know more about specific heat capacity, visit;

https://brainly.com/question/29766819

#SPJ1

SrBr2 + (NH4)2CO3
→ SrCO3 + NH4Br

Is this balanced? And if not how do I balance it?

Answers

Answer: No the equation is not balanced

Explanation:

Here's how to balance it:

SrBr2 + (NH4)2CO3 → SrCO3 + 2NH4Br

The balanced equation has 1 strontium atom, 2 bromine atoms, 1 carbon atom, 3 oxygen atoms, 4 hydrogen atoms, and 2 ammonium ions on both sides of the equation.

Answer:

No, the given equation is not balanced. The balanced equation is:

SrBr₂ + (NH₄)₂CO₃ → SrCO₃ + 2NH₄Br

Explanation:

A chemical equation is a representation of a chemical reaction using chemical formulas and symbols. It shows the reactant(s) on the left side of the equation and the product(s) on the right side of the equation, separated by an arrow that indicates the direction of the reaction.

[tex]\underbrace{\sf SrBr_2 + (NH_4)_2CO_3} \;\;\longrightarrow \;\;\underbrace{\sf SrCO_3 + NH_4Br}\\\sf \phantom{ww.w}Rectant(s) \qquad \qquad \quad \quad Product(s)[/tex]

A balanced chemical equation has the same number of atoms of each element on both sides of the equation.

Coefficients are used to balance chemical equations and are placed in front of a chemical symbol or formula where needed.

Given chemical equation:

[tex]\sf SrBr_2 + (NH_4)_2CO_3 \;\;\longrightarrow \;\; SrCO_3 + NH_4Br[/tex]

Here, we need to balance the number of Sr, Br, N, H, C, and O atoms.

Check to see if there are the same number of atoms of each element on both sides of the equation:

[tex]\begin{array}{|l|c|c|c|c|c|c|}\cline{1-7}\vphantom{\dfrac12}\sf &Sr&Br&N&H&C&O\\\cline{1-7}\vphantom{\dfrac12}\sf Reactant&1&2&2&8&1&3\\\cline{1-7}\vphantom{\dfrac12}\sf Product&1&1&1&4&1&3\\\cline{1-7}\end{array}[/tex]

We can see that there are two bromine atoms on the left but only one on the right, so a coefficient of 2 needs to be added to NH₄Br on the right side of the equation:

[tex]\sf SrBr_2 + (NH_4)_2CO_3 \;\;\longrightarrow \;\; SrCO_3 + 2NH_4Br[/tex]

By adding the coefficient 2 to NH₄Br on the right side of the equation, the number of N, H and Br atoms on this side have been multiplied by 2. So we now have:

[tex]\begin{array}{|l|c|c|c|c|c|c|}\cline{1-7}\vphantom{\dfrac12}\sf &Sr&Br&N&H&C&O\\\cline{1-7}\vphantom{\dfrac12}\sf Reactant&1&2&2&8&1&3\\\cline{1-7}\vphantom{\dfrac12}\sf Product&1&2&2&8&1&3\\\cline{1-7}\end{array}[/tex]

As there are now the same number of atoms of each element on both sides of the equation, it is balanced.

Therefore, the balanced chemical equation is:

[tex]\sf SrBr_2 + (NH_4)_2CO_3 \;\;\longrightarrow \;\; SrCO_3 + 2NH_4Br[/tex]

A 5.00-L tank contains helium gas at 1.50 atm. What is the pressure of the gas when the volume increased to 4.5atm?

Answers

Answer:

the pressure of the gas is 1.67 atm when the volume increased to 4.5 L.

Explanation:

Assuming the temperature and the amount of gas remain constant (i.e., the process is isobaric):

Using Boyle's law, we can relate the initial pressure (P1) and volume (V1) to the final pressure (P2) and volume (V2):

P1V1 = P2V2

Plugging in the given values:

P1 = 1.50 atm

V1 = 5.00 L

V2 = 4.5 L

Solving for P2:

P2 = (P1V1)/V2 = (1.50 atm x 5.00 L)/4.5 L = 1.67 atm

Give the conjugate acid of the following Bronsted-Lowry bases. (Type your answer using the format [OH]- for OH -.)

What is the conjugate acid of C7H5O2-

Answers

Answer:

The conjugate acid of a Bronsted-Lowry base is the species formed when it accepts a proton (H+).

C7H5O2- is a base because it can accept a proton to form its conjugate acid. To find the conjugate acid of C7H5O2-, we add a proton to it. The proton will bond with one of the oxygen atoms, and the resulting species will be:

C7H5O2H

Therefore, the conjugate acid of C7H5O2- is C7H5O2H.

Determine the enthalpy of reaction for HCl(g) + NaNO₂(s) → HNO₂(l) + NaCl(s) 2NaCl(s) + H₂O(l) → 2HCl(g) + Na₂O(s) ∆H° = -507.1 kJ/mol NO(g) + NO₂(g) + Na₂O(s) → 2NaNO₂(s) ∆H° = -427.0 kJ/mol NO(g) + NO₂(g) → N₂O(g) + O₂(g) ∆H° = -43.01 kJ/mol 2HNO₂(l) → N₂O(g) + O₂(g) + H₂O(l) ∆H° = +34.02 kJ/mol

Answers

the enthalpy of reaction for HCl(g) + NaNO₂(s) → HNO₂(l) + NaCl(s) 2NaCl(s) + H₂O(l) → 2HCl(g) + Na₂O(s) ∆H° = -507.1 kJ/mol NO(g) + NO₂(g) + Na₂O(s) → 2NaNO₂(s) ∆H° = -427.0 kJ/mol NO(g) + NO₂(g) → N₂O(g) + O₂(g) ∆H° = -43.01 kJ/mol 2HNO₂(l) → N₂O(g) + O₂(g) + H₂O(l) ∆H° = +34.02 kJ/mol the enthalpy of reaction for the given reaction is -39.1 kJ/mol.

We can use the given reactions and their enthalpies to find the enthalpy of reaction for the given equation.

The given equation is:

HCl(g) + NaNO₂(s) → HNO₂(l) + NaCl(s)

We can break down this reaction into several steps using the given reactions as follows:

Na₂O(s) + 2HCl(g) → 2NaCl(s) + H₂O(l) (reverse of the given reaction)

∆H° = +507.1 kJ/mol (reverse the sign of given reaction)

2NaCl(s) + H₂O(l) → Na₂O(s) + 2HCl(g)

∆H° = -507.1 kJ/mol (given reaction)

NO(g) + NO₂(g) + Na₂O(s) → 2NaNO₂(s)

∆H° = -427.0 kJ/mol (given reaction)

2HNO₂(l) → N₂O(g) + O₂(g) + H₂O(l)

∆H° = +34.02 kJ/mol (given reaction)

NO(g) + NO₂(g) → N₂O(g) + O₂(g)

∆H° = -43.01 kJ/mol (given reaction)

Now, we can add these equations and their enthalpies to get the overall enthalpy of the given reaction:

HCl(g) + NaNO₂(s) → HNO₂(l) + NaCl(s)

H₂O(l) + 2NaCl(s) → Na₂O(s) + 2HCl(g) ∆H° = -507.1 kJ/mol

Na₂O(s) + NO(g) + NO₂(g) → 2NaNO₂(s) ∆H° = -427.0 kJ/mol

2HNO₂(l) → N₂O(g) + O₂(g) + H₂O(l) ∆H° = +34.02 kJ/mol

NO(g) + NO₂(g) → N₂O(g) + O₂(g) ∆H° = -43.01 kJ/mol

HCl(g) + NaNO₂(s) → HNO₂(l) + NaCl(s) ∆H° = -39.1 kJ/mol

Learn more about enthalpy here:

https://brainly.com/question/13996238

#SPJ1

A student measures out exactly 0.1090
g of salicylic acid and carries out an aspirin synthesis using salicylic acid, acetic anhydride, heat, and an acid catalyst. Salicylic acid is the limiting reagent in this reaction, which yields 0.1000g of aspirin. What is the percent yield for the reaction?

Answers

The percent yield of aspirin in this reaction is 71.1%.

What is Percentage Yield?

Percentage yield is a measure of the efficiency of a chemical reaction, expressed as a percentage. It is calculated by dividing the actual yield of the desired product by the theoretical yield (the maximum amount of product that can be produced from the given amounts of reactants) and multiplying the result by 100%.

The balanced chemical equation for the reaction is:

C7H6O3 + C4H6O3 → C9H8O4 + C2H4O2

The molar mass of salicylic acid is 138.12 g/mol and the molar mass of aspirin is 180.16 g/mol.

First, we need to calculate the theoretical yield of aspirin:

1 mol salicylic acid = 1 mol aspirin

0.1090 g salicylic acid * (1 mol / 138.12 g) * (1 mol / 1 mol) * (180.16 g / 1 mol) = 0.1405 g aspirin (theoretical yield)

The percent yield is calculated by dividing the actual yield by the theoretical yield and multiplying by 100:

Percent yield = (actual yield / theoretical yield) x 100

Percent yield = (0.1000 g / 0.1405 g) x 100

Percent yield = 71.1%

Learn more about Percentage Yield from the given link

https://brainly.com/question/2451706

#SPJ1

Other Questions
the standards for implementing and evaluating sustainable design and development in the united states are known as: I have a masm program that has 2 arrays. They both have 4 values. I do not need inputs since I already have the values provided for me. One array is the points earned in a test and the other array is the points possible. In order to get the average I have to use the formula (points earned/points possible) * 100. I cant use a loop for this implementation. It has to be a simple masm program. The answers have to be stored in eax and edx grant, inc. had 60,000 shares of treasury stock ($10 par value) at december 31, 2014, which it acquired at $12 per share. on june 4, 2015, grant issued 30,000 treasury shares to employees who exercised options under grant's employee stock option plan. the market value per share was $14 at december 31, 2014, $15 at june 4, 2015, and $18 at december 31, 2015. the stock options had been granted for $13 per share. the cost method is used. what is the balance of the treasury stock on grant's balance sheet at december 31, 2015? why are conservative and liberal political ideologies incompatible with radical political attitudes? a. the radical political attitude centers the free market as the engine of political change. b. those political ideologies do not see the need to fundamentally reorder the political system. c. the radical political attitude advocates restoring values from previous or indeterminate regimes of the past. d. those ideologies advocate removing existing institutions. a water sample requires 5.28 ml of 0.0200 n h2so4 to lower the ph of 50.00 ml of sample to ph 4.3. the original ph of the sample was 6.7. a. what is the total alkalinity [alk] in eq/l in the original sample? what is most likely the dominant form contributing to the alkalinity at this ph? b. what is ct in the original sample? c. assuming this sample was originally open to the atmosphere (418 ppmv co2) and was in a closed system from the point of collection (meaning no additional gas exchange), can all the dissolved carbonate species be attributed to atmospheric co2, or must another source of carbonate be present as well? justify your decision using numbers as needed how does miller use diction or word choice to characterize john-proctor? include examples of procter's-diction in your answer. a recent high school graduate is searching for his first job. he turns down a job at a factory, hoping for better- paying work. what kind of unemployment is he experiencing? How much concentrated 18 M sulfuric acid is needed to prepare 250 ml of 6.0M solution? A species is a group of organisms that have similar traits and are able to produce fertileoffspring. What is meant by the term fertile offspring? Apply the distributive property to factor out the greatest common factor. 24a18b How is the point Niemller makes similar to the one that the poet Maurice Ogden makes in The Hangman? market segments that can be effectively reached and served are said to be . group of answer choices measurable profitable substantial accessible actionable Three examples of parallel structure 1. which of the following are considered money in the u.s. economy? which are not? explain your answers by discussing each of the three functions of money. a. a u.s. penny b. a mexican peso c. a picasso painting d. a plastic credit card Ill mark brainliest Directions: Research three news articles (7 points each) on the internet or in print relating tothe drug discussed in this lesson. Summarize what you learned in a one page report. Forexample, explain who is using this drug, what problems it is causing in society, where the drugis coming from, what law enforcement is doing to combat this drug, etc. Explain how theinformation you gathered has changed your views on this drug. (1 point) Be sure to site yoursources. which statement is true about informational presentations? a. they are based on emotional appeal. b. they depend on vivid imagery. c. they do not need to rely on logical presentation. d. they present ideas in logical sequence. a ball is projected horizontally above level ground from the top of a vertical cliff. the ball strikes the level ground 1 km away from the base of the cliff 4 seconds after it is fired. the height of the cliff is:a) 80b) 160c) 250 Solve for x. Round your answer to the nearest tenth if f(x) = 2x^2 + 3x - 1 and g(x)= 4x+ 10 then (f . g) (x) is whar rype of function?Linear Cubic Quartic QuadraticPLSS HELPPP im struggling with this question could someone help me please